Hematology and Oncology Book




Aka: Edoxaban, Savaysa
  1. See Also
    1. Factor Xa Inhibitor
    2. Anticoagulants
  2. Mechanism
    1. Factor Xa Inhibitor
  3. Indications
    1. Atrial Fibrillation Anticoagulation
    2. Deep Vein Thrombosis
      1. However, must be started concurrently with Heparin, unlike other Factor Xa Inhibitors (Apixaban, Rivaroxaban)
  4. Contraindications
    1. Creatinine Clearance <15 ml/min/1.73m2
    2. Creatinine Clearance >95 ml/min/1.73m2 (lower efficacy due to high drug clearance)
    3. Severe Cirrhosis (Child-Pugh Class C)
  5. Dosing
    1. Standard dose: 60 mg orally daily
    2. Half dose indications (30 mg orally daily)
      1. Creatinine Clearance 15 to 50 ml/min/1.73m2 OR
      2. Weight <60 kg
  6. Pharmacokinetics
    1. Oral bioavailability: 62%
    2. Half-life: 10-14 hours
    3. Onset: 1-2 hours
    4. Renal clearance 50%
  7. Drug Interactions
    1. Inducers
      1. Avoid Rifampin
    2. P-Glycoprotein Inhibitors
      1. Clarithromycin
      2. Dronedarone
      3. Itraconazole
      4. Ketoconazole
      5. Verapamil
  8. References
    1. Steinberg (2014) BMJ 348: g2116 +PMID:24733535 [PubMed]
    2. Wilbur (2017) Am Fam Physician 95(5): 295-302 [PubMed]
Medication Costs
savaysa (on 4/19/2017 at Medicaid.Gov Pharmacy Drug pricing)
SAVAYSA 30 MG TABLET $10.17 each
SAVAYSA 60 MG TABLET $10.10 each
FPNotebook does not benefit financially from showing this medication data or their pharmacy links. This information is provided only to help medical providers and their patients see relative costs. Insurance plans negotiate lower medication prices with suppliers. Prices shown here are out of pocket, non-negotiated rates. See Needy Meds for financial assistance information.

edoxaban (C2975435)

Definition (NCI) An orally active inhibitor of coagulation factor Xa (activated factor X) with anticoagulant activity. Edoxaban is administered as edoxaban tosylate. This agent has an elimination half-life of 9-11 hours and undergoes renal excretion.
Concepts Organic Chemical (T109) , Pharmacologic Substance (T121)
MSH C552171
English edoxaban, Edoxaban, Ethanediamide, n1-(5-chloro-2-pyridinyl)-n2-((1s,2r,4s)-4- ((dimethylamino)carbonyl)- 2-(((4,5,6,7-tetrahydro-5-methylthiazolo(5,4-c)pyridin-2-yl)carbonyl)amino)cyclohexyl)-, N-(5-chloropyridin-2-yl)-N'-((1S,2R,4S)-4-(N,N-dimethylcarbamoyl)-2-(5-methyl-4,5,6,7-tetrahydrothiazolo(5,4-c)pyridine-2-carboxamido)cyclohexyl)ethanediamide p-toluenesulfonate monohydrate, N-(5-chloropyridin-2-yl)-N'-[(1S,2R,4S)-4-(N,N-dimethylcarbamoyl)-2-(5-methyl-4,5,6,7- tetrahydro[1,3]thiazolo[5,4-c]pyridine-2-carboxamido)cyclohexyl]oxamide, EDOXABAN
Derived from the NIH UMLS (Unified Medical Language System)

You are currently viewing the original 'fpnotebook.com\legacy' version of this website. Internet Explorer 8.0 and older will automatically be redirected to this legacy version.

If you are using a modern web browser, you may instead navigate to the newer desktop version of fpnotebook. Another, mobile version is also available which should function on both newer and older web browsers.

Please Contact Me as you run across problems with any of these versions on the website.

Navigation Tree